C22H23ClN4O2 — CID 155370365
N-[(5-chloro-1H-indol-2-yl)methoxymethyl]-1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethanamine (PubChem CID 155370365) has the molecular formula C22H23ClN4O2 and a molecular weight of 410.91 g/mol. Its IUPAC name is N-[(5-chloro-1H-indol-2-yl)methoxymethyl]-1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethanamine.
| Compound Name | N-[(5-chloro-1H-indol-2-yl)methoxymethyl]-1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 155370365 |
| Molecular Formula | C22H23ClN4O2 |
| Molecular Weight | 410.91 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[(5-chloro-1H-indol-2-yl)methoxymethyl]-1-[1-(4-methoxyphenyl)pyrazol-4-yl]ethanamine |
| SMILES | COc1ccc(-n2cc(C(C)NCOCc3cc4cc(Cl)ccc4[nH]3)cn2)cc1 |
| InChI | InChI=1S/C22H23ClN4O2/c1-15(17-11-25-27(12-17)20-4-6-21(28-2)7-5-20)24-14-29-13-19-10-16-9-18(23)3-8-22(16)26-19/h3-12,15,24,26H,13-14H2,1-2H3 |
| InChIKey | VSCBPEATMFHUMU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.91 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|