C25H26N4O3S — CID 155370506
trans-(1R,2R)-N-isoquinolin-6-yl-2-[4-(1,2,3,6-tetrahydropyridin-5-ylmethylsulfamoyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 155370506) has the molecular formula C25H26N4O3S and a molecular weight of 462.58 g/mol. Its IUPAC name is trans-(1R,2R)-N-isoquinolin-6-yl-2-[4-(1,2,3,6-tetrahydropyridin-5-ylmethylsulfamoyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-isoquinolin-6-yl-2-[4-(1,2,3,6-tetrahydropyridin-5-ylmethylsulfamoyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 155370506 |
| Molecular Formula | C25H26N4O3S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | trans-(1R,2R)-N-isoquinolin-6-yl-2-[4-(1,2,3,6-tetrahydropyridin-5-ylmethylsulfamoyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccc2cnccc2c1)[C@@H]1C[C@H]1c1ccc(S(=O)(=O)NCC2=CCCNC2)cc1 |
| InChI | InChI=1S/C25H26N4O3S/c30-25(29-21-6-3-20-16-27-11-9-19(20)12-21)24-13-23(24)18-4-7-22(8-5-18)33(31,32)28-15-17-2-1-10-26-14-17/h2-9,11-12,16,23-24,26,28H,1,10,13-15H2,(H,29,30)/t23-,24+/m0/s1 |
| InChIKey | CCPDTXQLKCQBTQ-BJKOFHAPSA-N |
| XLogP | 3.17 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|