C29H43NO2S — CID 155373289
4-(3,4-dihydro-2H-chromen-6-yl)-N-hexylsulfanyl-2,5-dimethyl-3-[1-[(2-methylpropan-2-yl)oxy]ethyl]aniline (PubChem CID 155373289) has the molecular formula C29H43NO2S and a molecular weight of 469.74 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-6-yl)-N-hexylsulfanyl-2,5-dimethyl-3-[1-[(2-methylpropan-2-yl)oxy]ethyl]aniline.
| Compound Name | 4-(3,4-dihydro-2H-chromen-6-yl)-N-hexylsulfanyl-2,5-dimethyl-3-[1-[(2-methylpropan-2-yl)oxy]ethyl]aniline |
|---|---|
| PubChem CID | 155373289 |
| Molecular Formula | C29H43NO2S |
| Molecular Weight | 469.74 g/mol |
| Exact Mass | 469.30 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-6-yl)-N-hexylsulfanyl-2,5-dimethyl-3-[1-[(2-methylpropan-2-yl)oxy]ethyl]aniline |
| SMILES | CCCCCCSNc1cc(C)c(-c2ccc3c(c2)CCCO3)c(C(C)OC(C)(C)C)c1C |
| InChI | InChI=1S/C29H43NO2S/c1-8-9-10-11-17-33-30-25-18-20(2)27(28(21(25)3)22(4)32-29(5,6)7)24-14-15-26-23(19-24)13-12-16-31-26/h14-15,18-19,22,30H,8-13,16-17H2,1-7H3 |
| InChIKey | ZMEHTQUBIZBMGR-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.74 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|