C29H41NO6 — CID 90377444
2-[2-(3,4-dihydro-2H-chromen-6-yl)-5-(hexylperoxyamino)-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 90377444) has the molecular formula C29H41NO6 and a molecular weight of 499.65 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-2H-chromen-6-yl)-5-(hexylperoxyamino)-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[2-(3,4-dihydro-2H-chromen-6-yl)-5-(hexylperoxyamino)-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 90377444 |
| Molecular Formula | C29H41NO6 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 2-[2-(3,4-dihydro-2H-chromen-6-yl)-5-(hexylperoxyamino)-3,6-dimethylphenyl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | CCCCCCOONc1cc(C)c(-c2ccc3c(c2)CCCO3)c(C(OC(C)(C)C)C(=O)O)c1C |
| InChI | InChI=1S/C29H41NO6/c1-7-8-9-10-16-34-36-30-23-17-19(2)25(22-13-14-24-21(18-22)12-11-15-33-24)26(20(23)3)27(28(31)32)35-29(4,5)6/h13-14,17-18,27,30H,7-12,15-16H2,1-6H3,(H,31,32) |
| InChIKey | SJRSBPGPCQYASX-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|