C14H26N4O — CID 155374595
N-[(2Z,4E)-4-aminohexa-2,4-dienyl]-N-methyl-2-(4-methylpiperazin-1-yl)acetamide (PubChem CID 155374595) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is N-[(2Z,4E)-4-aminohexa-2,4-dienyl]-N-methyl-2-(4-methylpiperazin-1-yl)acetamide.
| Compound Name | N-[(2Z,4E)-4-aminohexa-2,4-dienyl]-N-methyl-2-(4-methylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 155374595 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | N-[(2Z,4E)-4-aminohexa-2,4-dienyl]-N-methyl-2-(4-methylpiperazin-1-yl)acetamide |
| SMILES | C/C=C(N)\C=C/CN(C)C(=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C14H26N4O/c1-4-13(15)6-5-7-17(3)14(19)12-18-10-8-16(2)9-11-18/h4-6H,7-12,15H2,1-3H3/b6-5-,13-4+ |
| InChIKey | KGDUFRQBLZQWOC-BDNXDWBHSA-N |
| XLogP | 0.11 |
| TPSA | 52.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|