C21H18F3N4O6P — CID 155375552
[2-amino-3-[3-[[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]methyl]-1,2-oxazol-5-yl]-2H-pyridin-1-yl]methyl dihydrogen phosphate (PubChem CID 155375552) has the molecular formula C21H18F3N4O6P and a molecular weight of 510.37 g/mol. Its IUPAC name is [2-amino-3-[3-[[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]methyl]-1,2-oxazol-5-yl]-2H-pyridin-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]methyl]-1,2-oxazol-5-yl]-2H-pyridin-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155375552 |
| Molecular Formula | C21H18F3N4O6P |
| Molecular Weight | 510.37 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | [2-amino-3-[3-[[4-[(3,5,6-trifluoro-2-pyridinyl)oxy]phenyl]methyl]-1,2-oxazol-5-yl]-2H-pyridin-1-yl]methyl dihydrogen phosphate |
| SMILES | NC1C(c2cc(Cc3ccc(Oc4nc(F)c(F)cc4F)cc3)no2)=CC=CN1COP(=O)(O)O |
| InChI | InChI=1S/C21H18F3N4O6P/c22-16-10-17(23)21(26-19(16)24)33-14-5-3-12(4-6-14)8-13-9-18(34-27-13)15-2-1-7-28(20(15)25)11-32-35(29,30)31/h1-7,9-10,20H,8,11,25H2,(H2,29,30,31) |
| InChIKey | QCHPUILUDFGKJN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 144.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|