C21H19FN4O6P+ — CID 155736890
[2-amino-3-[3-[[4-[(3-fluoro-2-pyridinyl)oxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate (PubChem CID 155736890) has the molecular formula C21H19FN4O6P+ and a molecular weight of 473.38 g/mol. Its IUPAC name is [2-amino-3-[3-[[4-[(3-fluoro-2-pyridinyl)oxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[4-[(3-fluoro-2-pyridinyl)oxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155736890 |
| Molecular Formula | C21H19FN4O6P+ |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | [2-amino-3-[3-[[4-[(3-fluoro-2-pyridinyl)oxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(Oc4ncccc4F)cc3)no2)ccc[n+]1COP(=O)(O)O |
| InChI | InChI=1S/C21H18FN4O6P/c22-18-4-1-9-24-21(18)31-16-7-5-14(6-8-16)11-15-12-19(32-25-15)17-3-2-10-26(20(17)23)13-30-33(27,28)29/h1-10,12,23H,11,13H2,(H2,27,28,29)/p+1 |
| InChIKey | QSDHMIIQQBZGIW-UHFFFAOYSA-O |
| XLogP | 3.20 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|