C24H24F2N4O6P+ — CID 155736670
[2-amino-3-[3-[[4-[(3,5-difluoro-2-methoxyanilino)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate (PubChem CID 155736670) has the molecular formula C24H24F2N4O6P+ and a molecular weight of 533.45 g/mol. Its IUPAC name is [2-amino-3-[3-[[4-[(3,5-difluoro-2-methoxyanilino)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[4-[(3,5-difluoro-2-methoxyanilino)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155736670 |
| Molecular Formula | C24H24F2N4O6P+ |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | [2-amino-3-[3-[[4-[(3,5-difluoro-2-methoxyanilino)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
| SMILES | COc1c(F)cc(F)cc1NCc1ccc(Cc2cc(-c3ccc[n+](COP(=O)(O)O)c3N)on2)cc1 |
| InChI | InChI=1S/C24H23F2N4O6P/c1-34-23-20(26)10-17(25)11-21(23)28-13-16-6-4-15(5-7-16)9-18-12-22(36-29-18)19-3-2-8-30(24(19)27)14-35-37(31,32)33/h2-8,10-12,27-28H,9,13-14H2,1H3,(H2,31,32,33)/p+1 |
| InChIKey | WRANWTKGGNMYNX-UHFFFAOYSA-O |
| XLogP | 3.77 |
| TPSA | 143.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|