C23H22FN3O6P+ — CID 138720924
[2-amino-3-[3-[[4-[(2-fluorophenyl)methoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate (PubChem CID 138720924) has the molecular formula C23H22FN3O6P+ and a molecular weight of 486.42 g/mol. Its IUPAC name is [2-amino-3-[3-[[4-[(2-fluorophenyl)methoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[4-[(2-fluorophenyl)methoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 138720924 |
| Molecular Formula | C23H22FN3O6P+ |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | [2-amino-3-[3-[[4-[(2-fluorophenyl)methoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(OCc4ccccc4F)cc3)no2)ccc[n+]1COP(=O)(O)O |
| InChI | InChI=1S/C23H21FN3O6P/c24-21-6-2-1-4-17(21)14-31-19-9-7-16(8-10-19)12-18-13-22(33-26-18)20-5-3-11-27(23(20)25)15-32-34(28,29)30/h1-11,13,25H,12,14-15H2,(H2,28,29,30)/p+1 |
| InChIKey | RYVTXEVNNXNWPD-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|