C23H23N3O6P+ — CID 138682168
[2-amino-3-[3-[(4-phenylmethoxyphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate (PubChem CID 138682168) has the molecular formula C23H23N3O6P+ and a molecular weight of 468.43 g/mol. Its IUPAC name is [2-amino-3-[3-[(4-phenylmethoxyphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[(4-phenylmethoxyphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 138682168 |
| Molecular Formula | C23H23N3O6P+ |
| Molecular Weight | 468.43 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | [2-amino-3-[3-[(4-phenylmethoxyphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(OCc4ccccc4)cc3)no2)ccc[n+]1COP(=O)(O)O |
| InChI | InChI=1S/C23H22N3O6P/c24-23-21(7-4-12-26(23)16-31-33(27,28)29)22-14-19(25-32-22)13-17-8-10-20(11-9-17)30-15-18-5-2-1-3-6-18/h1-12,14,24H,13,15-16H2,(H2,27,28,29)/p+1 |
| InChIKey | BXAHPTPOALXQBD-UHFFFAOYSA-O |
| XLogP | 3.45 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|