C19H20N4O6P+ — CID 155736846
[2-amino-3-[3-[(6-but-3-ynoxy-3-pyridinyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate (PubChem CID 155736846) has the molecular formula C19H20N4O6P+ and a molecular weight of 431.37 g/mol. Its IUPAC name is [2-amino-3-[3-[(6-but-3-ynoxy-3-pyridinyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[(6-but-3-ynoxy-3-pyridinyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155736846 |
| Molecular Formula | C19H20N4O6P+ |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | [2-amino-3-[3-[(6-but-3-ynoxy-3-pyridinyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
| SMILES | C#CCCOc1ccc(Cc2cc(-c3ccc[n+](COP(=O)(O)O)c3N)on2)cn1 |
| InChI | InChI=1S/C19H19N4O6P/c1-2-3-9-27-18-7-6-14(12-21-18)10-15-11-17(29-22-15)16-5-4-8-23(19(16)20)13-28-30(24,25)26/h1,4-8,11-12,20H,3,9-10,13H2,(H2,24,25,26)/p+1 |
| InChIKey | KCVUMFBWYSZRBU-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|