C21H19FN5O6P — CID 138721166
[2-amino-3-[3-[[6-[(2-fluoro-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate (PubChem CID 138721166) has the molecular formula C21H19FN5O6P and a molecular weight of 487.38 g/mol. Its IUPAC name is [2-amino-3-[3-[[6-[(2-fluoro-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[6-[(2-fluoro-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 138721166 |
| Molecular Formula | C21H19FN5O6P |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | [2-amino-3-[3-[[6-[(2-fluoro-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(OCc4ccnc(F)c4)nc3)no2)ccc[n+]1COP(=O)([O-])O |
| InChI | InChI=1S/C21H19FN5O6P/c22-19-9-15(5-6-24-19)12-31-20-4-3-14(11-25-20)8-16-10-18(33-26-16)17-2-1-7-27(21(17)23)13-32-34(28,29)30/h1-7,9-11,23H,8,12-13H2,(H2,28,29,30) |
| InChIKey | ZJGYHBCMGIYBJP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 160.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|