C19H18N5O7P — CID 155736870
[2-amino-3-[3-[[6-(1,3-oxazol-2-ylmethoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate (PubChem CID 155736870) has the molecular formula C19H18N5O7P and a molecular weight of 459.36 g/mol. Its IUPAC name is [2-amino-3-[3-[[6-(1,3-oxazol-2-ylmethoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[6-(1,3-oxazol-2-ylmethoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 155736870 |
| Molecular Formula | C19H18N5O7P |
| Molecular Weight | 459.36 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | [2-amino-3-[3-[[6-(1,3-oxazol-2-ylmethoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(OCc4ncco4)nc3)no2)ccc[n+]1COP(=O)([O-])O |
| InChI | InChI=1S/C19H18N5O7P/c20-19-15(2-1-6-24(19)12-30-32(25,26)27)16-9-14(23-31-16)8-13-3-4-17(22-10-13)29-11-18-21-5-7-28-18/h1-7,9-10,20H,8,11-12H2,(H2,25,26,27) |
| InChIKey | KFGIETMUNPQQEH-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 173.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.36 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|