C22H21N4O5P — CID 155736883
[2-amino-3-[3-[[4-(pyridin-3-ylmethyl)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate (PubChem CID 155736883) has the molecular formula C22H21N4O5P and a molecular weight of 452.41 g/mol. Its IUPAC name is [2-amino-3-[3-[[4-(pyridin-3-ylmethyl)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[4-(pyridin-3-ylmethyl)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 155736883 |
| Molecular Formula | C22H21N4O5P |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [2-amino-3-[3-[[4-(pyridin-3-ylmethyl)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(Cc4cccnc4)cc3)no2)ccc[n+]1COP(=O)([O-])O |
| InChI | InChI=1S/C22H21N4O5P/c23-22-20(4-2-10-26(22)15-30-32(27,28)29)21-13-19(25-31-21)12-17-7-5-16(6-8-17)11-18-3-1-9-24-14-18/h1-10,13-14,23H,11-12,15H2,(H2,27,28,29) |
| InChIKey | PCBOLKRFYQAINW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|