C21H25N4O6P — CID 155736671
[2,6-diamino-3-[3-[[4-(3-methylbut-2-enoxy)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate (PubChem CID 155736671) has the molecular formula C21H25N4O6P and a molecular weight of 460.43 g/mol. Its IUPAC name is [2,6-diamino-3-[3-[[4-(3-methylbut-2-enoxy)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate.
| Compound Name | [2,6-diamino-3-[3-[[4-(3-methylbut-2-enoxy)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 155736671 |
| Molecular Formula | C21H25N4O6P |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | [2,6-diamino-3-[3-[[4-(3-methylbut-2-enoxy)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
| SMILES | CC(C)=CCOc1ccc(Cc2cc(-c3ccc(N)[n+](COP(=O)([O-])O)c3N)on2)cc1 |
| InChI | InChI=1S/C21H25N4O6P/c1-14(2)9-10-29-17-5-3-15(4-6-17)11-16-12-19(31-24-16)18-7-8-20(22)25(21(18)23)13-30-32(26,27)28/h3-9,12H,10-11,13H2,1-2H3,(H5,22,23,24,26,27,28) |
| InChIKey | WZRMYJMOEBQBMS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 160.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|