C22H21FN4O5P+ — CID 155736614
[2-amino-3-[3-[[4-[(2-fluoro-4-pyridinyl)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate (PubChem CID 155736614) has the molecular formula C22H21FN4O5P+ and a molecular weight of 471.41 g/mol. Its IUPAC name is [2-amino-3-[3-[[4-[(2-fluoro-4-pyridinyl)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[4-[(2-fluoro-4-pyridinyl)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155736614 |
| Molecular Formula | C22H21FN4O5P+ |
| Molecular Weight | 471.41 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | [2-amino-3-[3-[[4-[(2-fluoro-4-pyridinyl)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(Cc4ccnc(F)c4)cc3)no2)ccc[n+]1COP(=O)(O)O |
| InChI | InChI=1S/C22H20FN4O5P/c23-21-12-17(7-8-25-21)10-15-3-5-16(6-4-15)11-18-13-20(32-26-18)19-2-1-9-27(22(19)24)14-31-33(28,29)30/h1-9,12-13,24H,10-11,14H2,(H2,28,29,30)/p+1 |
| InChIKey | ACEPXADBOLAYQL-UHFFFAOYSA-O |
| XLogP | 2.99 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|