C24H24N6O5P+ — CID 158417055
[2-amino-3-[3-[[4-[2-(3-azidophenyl)ethyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate (PubChem CID 158417055) has the molecular formula C24H24N6O5P+ and a molecular weight of 507.47 g/mol. Its IUPAC name is [2-amino-3-[3-[[4-[2-(3-azidophenyl)ethyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[4-[2-(3-azidophenyl)ethyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 158417055 |
| Molecular Formula | C24H24N6O5P+ |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | [2-amino-3-[3-[[4-[2-(3-azidophenyl)ethyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
| SMILES | [N-]=[N+]=Nc1cccc(CCc2ccc(Cc3cc(-c4ccc[n+](COP(=O)(O)O)c4N)on3)cc2)c1 |
| InChI | InChI=1S/C24H23N6O5P/c25-24-22(5-2-12-30(24)16-34-36(31,32)33)23-15-21(28-35-23)14-19-10-7-17(8-11-19)6-9-18-3-1-4-20(13-18)27-29-26/h1-5,7-8,10-13,15,25H,6,9,14,16H2,(H2,31,32,33)/p+1 |
| InChIKey | HAAHNGLOFSTSPG-UHFFFAOYSA-O |
| XLogP | 4.60 |
| TPSA | 171.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|