C24H24FN3O5P+ — CID 159642091
[2-amino-3-[3-[[4-[2-(3-fluorophenyl)ethyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate (PubChem CID 159642091) has the molecular formula C24H24FN3O5P+ and a molecular weight of 484.44 g/mol. Its IUPAC name is [2-amino-3-[3-[[4-[2-(3-fluorophenyl)ethyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[4-[2-(3-fluorophenyl)ethyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 159642091 |
| Molecular Formula | C24H24FN3O5P+ |
| Molecular Weight | 484.44 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | [2-amino-3-[3-[[4-[2-(3-fluorophenyl)ethyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(CCc4cccc(F)c4)cc3)no2)ccc[n+]1COP(=O)(O)O |
| InChI | InChI=1S/C24H23FN3O5P/c25-20-4-1-3-18(13-20)9-6-17-7-10-19(11-8-17)14-21-15-23(33-27-21)22-5-2-12-28(24(22)26)16-32-34(29,30)31/h1-5,7-8,10-13,15,26H,6,9,14,16H2,(H2,29,30,31)/p+1 |
| InChIKey | MQMHNVNZPNOKBO-UHFFFAOYSA-O |
| XLogP | 3.79 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|