C20H24N4O6P+ — CID 155375643
[2-amino-3-[3-[[6-(cyclobutylmethoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate (PubChem CID 155375643) has the molecular formula C20H24N4O6P+ and a molecular weight of 447.41 g/mol. Its IUPAC name is [2-amino-3-[3-[[6-(cyclobutylmethoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[6-(cyclobutylmethoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155375643 |
| Molecular Formula | C20H24N4O6P+ |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | [2-amino-3-[3-[[6-(cyclobutylmethoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(OCC4CCC4)nc3)no2)ccc[n+]1COP(=O)(O)O |
| InChI | InChI=1S/C20H23N4O6P/c21-20-17(5-2-8-24(20)13-29-31(25,26)27)18-10-16(23-30-18)9-15-6-7-19(22-11-15)28-12-14-3-1-4-14/h2,5-8,10-11,14,21H,1,3-4,9,12-13H2,(H2,25,26,27)/p+1 |
| InChIKey | FWPHHRVZBHOFQW-UHFFFAOYSA-O |
| XLogP | 2.44 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|