C25H28N4O6P+ — CID 155736580
[2-amino-3-[3-[[6-(2-methyl-2-phenylpropoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate (PubChem CID 155736580) has the molecular formula C25H28N4O6P+ and a molecular weight of 511.50 g/mol. Its IUPAC name is [2-amino-3-[3-[[6-(2-methyl-2-phenylpropoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[6-(2-methyl-2-phenylpropoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 155736580 |
| Molecular Formula | C25H28N4O6P+ |
| Molecular Weight | 511.50 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | [2-amino-3-[3-[[6-(2-methyl-2-phenylpropoxy)-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl dihydrogen phosphate |
| SMILES | CC(C)(COc1ccc(Cc2cc(-c3ccc[n+](COP(=O)(O)O)c3N)on2)cn1)c1ccccc1 |
| InChI | InChI=1S/C25H27N4O6P/c1-25(2,19-7-4-3-5-8-19)16-33-23-11-10-18(15-27-23)13-20-14-22(35-28-20)21-9-6-12-29(24(21)26)17-34-36(30,31)32/h3-12,14-15,26H,13,16-17H2,1-2H3,(H2,30,31,32)/p+1 |
| InChIKey | GKUQKGUMJALKBJ-UHFFFAOYSA-O |
| XLogP | 3.62 |
| TPSA | 144.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|