C25H28N4O5PS+ — CID 155736817
[2-amino-3-[3-[[4-[[3-(methylsulfanylamino)phenyl]methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphate (PubChem CID 155736817) has the molecular formula C25H28N4O5PS+ and a molecular weight of 527.56 g/mol. Its IUPAC name is [2-amino-3-[3-[[4-[[3-(methylsulfanylamino)phenyl]methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphate.
| Compound Name | [2-amino-3-[3-[[4-[[3-(methylsulfanylamino)phenyl]methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 155736817 |
| Molecular Formula | C25H28N4O5PS+ |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | [2-amino-3-[3-[[4-[[3-(methylsulfanylamino)phenyl]methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC[n+]1cccc(-c2cc(Cc3ccc(Cc4cccc(NSC)c4)cc3)no2)c1N |
| InChI | InChI=1S/C25H27N4O5PS/c1-32-35(30,31)33-17-29-12-4-7-23(25(29)26)24-16-22(27-34-24)14-19-10-8-18(9-11-19)13-20-5-3-6-21(15-20)28-36-2/h3-12,15-16,26,28H,13-14,17H2,1-2H3,(H,30,31)/p+1 |
| InChIKey | FCQUDHMDUXIPAR-UHFFFAOYSA-O |
| XLogP | 4.80 |
| TPSA | 123.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|