C21H26N4O6PS+ — CID 170221144
[2-amino-3-[3-[(4-morpholin-4-ylsulfanylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphate (PubChem CID 170221144) has the molecular formula C21H26N4O6PS+ and a molecular weight of 493.50 g/mol. Its IUPAC name is [2-amino-3-[3-[(4-morpholin-4-ylsulfanylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphate.
| Compound Name | [2-amino-3-[3-[(4-morpholin-4-ylsulfanylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphate |
|---|---|
| PubChem CID | 170221144 |
| Molecular Formula | C21H26N4O6PS+ |
| Molecular Weight | 493.50 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | [2-amino-3-[3-[(4-morpholin-4-ylsulfanylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphate |
| SMILES | COP(=O)(O)OC[n+]1cccc(-c2cc(Cc3ccc(SN4CCOCC4)cc3)no2)c1N |
| InChI | InChI=1S/C21H25N4O6PS/c1-28-32(26,27)30-15-24-8-2-3-19(21(24)22)20-14-17(23-31-20)13-16-4-6-18(7-5-16)33-25-9-11-29-12-10-25/h2-8,14,22H,9-13,15H2,1H3,(H,26,27)/p+1 |
| InChIKey | QZFMNJBHWIFQIB-UHFFFAOYSA-O |
| XLogP | 2.86 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|