C20H23N4O8PS — CID 155736528
[2-amino-3-[3-[(4-morpholin-4-ylsulfonylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate (PubChem CID 155736528) has the molecular formula C20H23N4O8PS and a molecular weight of 510.47 g/mol. Its IUPAC name is [2-amino-3-[3-[(4-morpholin-4-ylsulfonylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate.
| Compound Name | [2-amino-3-[3-[(4-morpholin-4-ylsulfonylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 155736528 |
| Molecular Formula | C20H23N4O8PS |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | [2-amino-3-[3-[(4-morpholin-4-ylsulfonylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl hydrogen phosphate |
| SMILES | Nc1c(-c2cc(Cc3ccc(S(=O)(=O)N4CCOCC4)cc3)no2)ccc[n+]1COP(=O)([O-])O |
| InChI | InChI=1S/C20H23N4O8PS/c21-20-18(2-1-7-23(20)14-31-33(25,26)27)19-13-16(22-32-19)12-15-3-5-17(6-4-15)34(28,29)24-8-10-30-11-9-24/h1-7,13,21H,8-12,14H2,(H2,25,26,27) |
| InChIKey | VRBJDBQVIDENJB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 172.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|