C23H23FN4O5P+ — CID 155736628
[2-amino-3-[3-[[6-[(3-fluorophenyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphite (PubChem CID 155736628) has the molecular formula C23H23FN4O5P+ and a molecular weight of 485.43 g/mol. Its IUPAC name is [2-amino-3-[3-[[6-[(3-fluorophenyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphite.
| Compound Name | [2-amino-3-[3-[[6-[(3-fluorophenyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphite |
|---|---|
| PubChem CID | 155736628 |
| Molecular Formula | C23H23FN4O5P+ |
| Molecular Weight | 485.43 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | [2-amino-3-[3-[[6-[(3-fluorophenyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-1-yl]methyl methyl hydrogen phosphite |
| SMILES | COP(O)OC[n+]1cccc(-c2cc(Cc3ccc(OCc4cccc(F)c4)nc3)no2)c1N |
| InChI | InChI=1S/C23H22FN4O5P/c1-30-34(29)32-15-28-9-3-6-20(23(28)25)21-12-19(27-33-21)11-16-7-8-22(26-13-16)31-14-17-4-2-5-18(24)10-17/h2-10,12-13,25,29H,11,14-15H2,1H3/p+1 |
| InChIKey | KGVWRKZRDYBREO-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|