C24H25N4O2+ — CID 163830432
1-propyl-3-[3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-2-amine (PubChem CID 163830432) has the molecular formula C24H25N4O2+ and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-propyl-3-[3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-2-amine.
| Compound Name | 1-propyl-3-[3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 163830432 |
| Molecular Formula | C24H25N4O2+ |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 1-propyl-3-[3-[[4-(pyridin-2-yloxymethyl)phenyl]methyl]-1,2-oxazol-5-yl]pyridin-1-ium-2-amine |
| SMILES | CCC[n+]1cccc(-c2cc(Cc3ccc(COc4ccccn4)cc3)no2)c1N |
| InChI | InChI=1S/C24H24N4O2/c1-2-13-28-14-5-6-21(24(28)25)22-16-20(27-30-22)15-18-8-10-19(11-9-18)17-29-23-7-3-4-12-26-23/h3-12,14,16,25H,2,13,15,17H2,1H3/p+1 |
| InChIKey | ODFHBHJVKBAPRP-UHFFFAOYSA-O |
| XLogP | 4.19 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|