C20H16N4O — CID 138682184
3-[3-[(4-pyridin-2-ylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-2-amine (PubChem CID 138682184) has the molecular formula C20H16N4O and a molecular weight of 328.38 g/mol. Its IUPAC name is 3-[3-[(4-pyridin-2-ylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-2-amine.
| Compound Name | 3-[3-[(4-pyridin-2-ylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 138682184 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 3-[3-[(4-pyridin-2-ylphenyl)methyl]-1,2-oxazol-5-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1cc(Cc2ccc(-c3ccccn3)cc2)no1 |
| InChI | InChI=1S/C20H16N4O/c21-20-17(4-3-11-23-20)19-13-16(24-25-19)12-14-6-8-15(9-7-14)18-5-1-2-10-22-18/h1-11,13H,12H2,(H2,21,23) |
| InChIKey | IFKWDLREMODPCS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |