C24H22N4O2 — CID 155375618
3-[3-[[4-[[4-[(methylideneamino)methyl]phenyl]methoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine (PubChem CID 155375618) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 3-[3-[[4-[[4-[(methylideneamino)methyl]phenyl]methoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine.
| Compound Name | 3-[3-[[4-[[4-[(methylideneamino)methyl]phenyl]methoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 155375618 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-[3-[[4-[[4-[(methylideneamino)methyl]phenyl]methoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine |
| SMILES | C=NCc1ccc(COc2ccc(Cc3cc(-c4cccnc4N)on3)cc2)cc1 |
| InChI | InChI=1S/C24H22N4O2/c1-26-15-18-4-6-19(7-5-18)16-29-21-10-8-17(9-11-21)13-20-14-23(30-28-20)22-3-2-12-27-24(22)25/h2-12,14H,1,13,15-16H2,(H2,25,27) |
| InChIKey | GSTIPVOACBJILM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|