C23H28N4O2 — CID 143451276
ethane;3-[3-[[4-[(E)-2-methyl-4-methyliminobut-2-enoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine (PubChem CID 143451276) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is ethane;3-[3-[[4-[(E)-2-methyl-4-methyliminobut-2-enoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine.
| Compound Name | ethane;3-[3-[[4-[(E)-2-methyl-4-methyliminobut-2-enoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 143451276 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | ethane;3-[3-[[4-[(E)-2-methyl-4-methyliminobut-2-enoxy]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine |
| SMILES | C/N=C/C=C(\C)COc1ccc(Cc2cc(-c3cccnc3N)on2)cc1.CC |
| InChI | InChI=1S/C21H22N4O2.C2H6/c1-15(9-11-23-2)14-26-18-7-5-16(6-8-18)12-17-13-20(27-25-17)19-4-3-10-24-21(19)22;1-2/h3-11,13H,12,14H2,1-2H3,(H2,22,24);1-2H3/b15-9+,23-11+; |
| InChIKey | CPIPMHQRITZBLS-BGGWUYMPSA-N |
| XLogP | 4.96 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|