C21H16F2N4O — CID 138682322
3-[3-[[4-[(2,6-difluoro-4-pyridinyl)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine (PubChem CID 138682322) has the molecular formula C21H16F2N4O and a molecular weight of 378.38 g/mol. Its IUPAC name is 3-[3-[[4-[(2,6-difluoro-4-pyridinyl)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine.
| Compound Name | 3-[3-[[4-[(2,6-difluoro-4-pyridinyl)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 138682322 |
| Molecular Formula | C21H16F2N4O |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 3-[3-[[4-[(2,6-difluoro-4-pyridinyl)methyl]phenyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1cc(Cc2ccc(Cc3cc(F)nc(F)c3)cc2)no1 |
| InChI | InChI=1S/C21H16F2N4O/c22-19-10-15(11-20(23)26-19)8-13-3-5-14(6-4-13)9-16-12-18(28-27-16)17-2-1-7-25-21(17)24/h1-7,10-12H,8-9H2,(H2,24,25) |
| InChIKey | UGTPFDKNEKGRRJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|