C20H16BrN5O2 — CID 138682075
3-[3-[[6-[(2-bromo-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine (PubChem CID 138682075) has the molecular formula C20H16BrN5O2 and a molecular weight of 438.29 g/mol. Its IUPAC name is 3-[3-[[6-[(2-bromo-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine.
| Compound Name | 3-[3-[[6-[(2-bromo-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 138682075 |
| Molecular Formula | C20H16BrN5O2 |
| Molecular Weight | 438.29 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 3-[3-[[6-[(2-bromo-4-pyridinyl)methoxy]-3-pyridinyl]methyl]-1,2-oxazol-5-yl]pyridin-2-amine |
| SMILES | Nc1ncccc1-c1cc(Cc2ccc(OCc3ccnc(Br)c3)nc2)no1 |
| InChI | InChI=1S/C20H16BrN5O2/c21-18-9-14(5-7-23-18)12-27-19-4-3-13(11-25-19)8-15-10-17(28-26-15)16-2-1-6-24-20(16)22/h1-7,9-11H,8,12H2,(H2,22,24) |
| InChIKey | NGADMZUUFGQELY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|