C22H21F5N8 — CID 155376419
4-[8-fluoro-8-methyl-5-(1,1,2,2-tetrafluoroethyl)-3,4,6,10-tetrazatricyclo[8.3.0.02,6]trideca-1(13),2,4,11-tetraen-12-yl]-5-methyl-N-(2-methylpyrazol-3-yl)pyridin-2-amine (PubChem CID 155376419) has the molecular formula C22H21F5N8 and a molecular weight of 492.46 g/mol. Its IUPAC name is 4-[8-fluoro-8-methyl-5-(1,1,2,2-tetrafluoroethyl)-3,4,6,10-tetrazatricyclo[8.3.0.02,6]trideca-1(13),2,4,11-tetraen-12-yl]-5-methyl-N-(2-methylpyrazol-3-yl)pyridin-2-amine.
| Compound Name | 4-[8-fluoro-8-methyl-5-(1,1,2,2-tetrafluoroethyl)-3,4,6,10-tetrazatricyclo[8.3.0.02,6]trideca-1(13),2,4,11-tetraen-12-yl]-5-methyl-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 155376419 |
| Molecular Formula | C22H21F5N8 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 4-[8-fluoro-8-methyl-5-(1,1,2,2-tetrafluoroethyl)-3,4,6,10-tetrazatricyclo[8.3.0.02,6]trideca-1(13),2,4,11-tetraen-12-yl]-5-methyl-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
| SMILES | Cc1cnc(Nc2ccnn2C)cc1-c1cc2n(c1)CC(C)(F)Cn1c-2nnc1C(F)(F)C(F)F |
| InChI | InChI=1S/C22H21F5N8/c1-12-8-28-16(30-17-4-5-29-33(17)3)7-14(12)13-6-15-18-31-32-20(22(26,27)19(23)24)35(18)11-21(2,25)10-34(15)9-13/h4-9,19H,10-11H2,1-3H3,(H,28,30) |
| InChIKey | APESIMCHDGRSCR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|