C21H18F6N8 — CID 155376595
4-[(7R)-7-(fluoromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-11-yl]-5-methyl-N-(2-methylpyrazol-3-yl)pyridin-2-amine (PubChem CID 155376595) has the molecular formula C21H18F6N8 and a molecular weight of 496.42 g/mol. Its IUPAC name is 4-[(7R)-7-(fluoromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-11-yl]-5-methyl-N-(2-methylpyrazol-3-yl)pyridin-2-amine.
| Compound Name | 4-[(7R)-7-(fluoromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-11-yl]-5-methyl-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 155376595 |
| Molecular Formula | C21H18F6N8 |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 4-[(7R)-7-(fluoromethyl)-5-(1,1,2,2,2-pentafluoroethyl)-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-11-yl]-5-methyl-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
| SMILES | Cc1cnc(Nc2ccnn2C)cc1-c1cc2n(c1)C[C@H](CF)n1c-2nnc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H18F6N8/c1-11-8-28-16(30-17-3-4-29-33(17)2)6-14(11)12-5-15-18-31-32-19(20(23,24)21(25,26)27)35(18)13(7-22)10-34(15)9-12/h3-6,8-9,13H,7,10H2,1-2H3,(H,28,30)/t13-/m0/s1 |
| InChIKey | PJCDCNJKYBMHPY-ZDUSSCGKSA-N |
| XLogP | 4.77 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|