C19H20BrClN6O — CID 155377292
N,N'-diamino-4-bromo-5-chloro-3-morpholin-4-yl-1-phenylindole-2-carboximidamide (PubChem CID 155377292) has the molecular formula C19H20BrClN6O and a molecular weight of 463.77 g/mol. Its IUPAC name is N,N'-diamino-4-bromo-5-chloro-3-morpholin-4-yl-1-phenylindole-2-carboximidamide.
| Compound Name | N,N'-diamino-4-bromo-5-chloro-3-morpholin-4-yl-1-phenylindole-2-carboximidamide |
|---|---|
| PubChem CID | 155377292 |
| Molecular Formula | C19H20BrClN6O |
| Molecular Weight | 463.77 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N,N'-diamino-4-bromo-5-chloro-3-morpholin-4-yl-1-phenylindole-2-carboximidamide |
| SMILES | N/N=C(\NN)c1c(N2CCOCC2)c2c(Br)c(Cl)ccc2n1-c1ccccc1 |
| InChI | InChI=1S/C19H20BrClN6O/c20-16-13(21)6-7-14-15(16)17(26-8-10-28-11-9-26)18(19(24-22)25-23)27(14)12-4-2-1-3-5-12/h1-7H,8-11,22-23H2,(H,24,25) |
| InChIKey | QUZZEXPJBAKUNR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.77 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|