C27H30N6O4 — CID 155380314
N-[5-[[(4-hydroxycyclohexyl)amino]methyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]benzimidazol-2-yl]-1,2-oxazole-5-carboxamide (PubChem CID 155380314) has the molecular formula C27H30N6O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is N-[5-[[(4-hydroxycyclohexyl)amino]methyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]benzimidazol-2-yl]-1,2-oxazole-5-carboxamide.
| Compound Name | N-[5-[[(4-hydroxycyclohexyl)amino]methyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]benzimidazol-2-yl]-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 155380314 |
| Molecular Formula | C27H30N6O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | N-[5-[[(4-hydroxycyclohexyl)amino]methyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]benzimidazol-2-yl]-1,2-oxazole-5-carboxamide |
| SMILES | C=CC(O)Nc1cccc(-n2c(NC(=O)c3ccno3)nc3cc(CNC4CCC(O)CC4)ccc32)c1 |
| InChI | InChI=1S/C27H30N6O4/c1-2-25(35)30-19-4-3-5-20(15-19)33-23-11-6-17(16-28-18-7-9-21(34)10-8-18)14-22(23)31-27(33)32-26(36)24-12-13-29-37-24/h2-6,11-15,18,21,25,28,30,34-35H,1,7-10,16H2,(H,31,32,36) |
| InChIKey | FWWLAKIYMJEDHN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 137.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|