C19H20ClN3O2S — CID 155382960
N-[4-chloro-3-(piperidine-1-carbonyl)phenyl]-2-methylsulfanylpyridine-3-carboxamide (PubChem CID 155382960) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is N-[4-chloro-3-(piperidine-1-carbonyl)phenyl]-2-methylsulfanylpyridine-3-carboxamide.
| Compound Name | N-[4-chloro-3-(piperidine-1-carbonyl)phenyl]-2-methylsulfanylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 155382960 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-[4-chloro-3-(piperidine-1-carbonyl)phenyl]-2-methylsulfanylpyridine-3-carboxamide |
| SMILES | CSc1ncccc1C(=O)Nc1ccc(Cl)c(C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H20ClN3O2S/c1-26-18-14(6-5-9-21-18)17(24)22-13-7-8-16(20)15(12-13)19(25)23-10-3-2-4-11-23/h5-9,12H,2-4,10-11H2,1H3,(H,22,24) |
| InChIKey | AISYDLFZWRHFKJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |