C27H30F6N6O4S2 — CID 155383183
2-[2-fluoro-4-[(2,3,4,5,6-pentafluorophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-1-methyl-N-(5-methyl-1H-pyrazol-3-yl)-6-morpholin-4-yl-1,3-diazinan-4-amine (PubChem CID 155383183) has the molecular formula C27H30F6N6O4S2 and a molecular weight of 680.70 g/mol. Its IUPAC name is 2-[2-fluoro-4-[(2,3,4,5,6-pentafluorophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-1-methyl-N-(5-methyl-1H-pyrazol-3-yl)-6-morpholin-4-yl-1,3-diazinan-4-amine.
| Compound Name | 2-[2-fluoro-4-[(2,3,4,5,6-pentafluorophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-1-methyl-N-(5-methyl-1H-pyrazol-3-yl)-6-morpholin-4-yl-1,3-diazinan-4-amine |
|---|---|
| PubChem CID | 155383183 |
| Molecular Formula | C27H30F6N6O4S2 |
| Molecular Weight | 680.70 g/mol |
| Exact Mass | 680.17 |
| IUPAC Name | 2-[2-fluoro-4-[(2,3,4,5,6-pentafluorophenyl)methylsulfonyl]phenyl]sulfanyl-5-methoxy-1-methyl-N-(5-methyl-1H-pyrazol-3-yl)-6-morpholin-4-yl-1,3-diazinan-4-amine |
| SMILES | COC1C(Nc2cc(C)[nH]n2)NC(Sc2ccc(S(=O)(=O)Cc3c(F)c(F)c(F)c(F)c3F)cc2F)N(C)C1N1CCOCC1 |
| InChI | InChI=1S/C27H30F6N6O4S2/c1-13-10-18(37-36-13)34-25-24(42-3)26(39-6-8-43-9-7-39)38(2)27(35-25)44-17-5-4-14(11-16(17)28)45(40,41)12-15-19(29)21(31)23(33)22(32)20(15)30/h4-5,10-11,24-27,35H,6-9,12H2,1-3H3,(H2,34,36,37) |
| InChIKey | KCYNRLQJKZWZFB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 111.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|