C24H31Cl2F — CID 155383409
1-chloro-2-[5-(2-chloro-4-propan-2-ylphenyl)hexan-2-yl]-4-fluoro-5-propan-2-ylbenzene (PubChem CID 155383409) has the molecular formula C24H31Cl2F and a molecular weight of 409.42 g/mol. Its IUPAC name is 1-chloro-2-[5-(2-chloro-4-propan-2-ylphenyl)hexan-2-yl]-4-fluoro-5-propan-2-ylbenzene.
| Compound Name | 1-chloro-2-[5-(2-chloro-4-propan-2-ylphenyl)hexan-2-yl]-4-fluoro-5-propan-2-ylbenzene |
|---|---|
| PubChem CID | 155383409 |
| Molecular Formula | C24H31Cl2F |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-chloro-2-[5-(2-chloro-4-propan-2-ylphenyl)hexan-2-yl]-4-fluoro-5-propan-2-ylbenzene |
| SMILES | CC(C)c1ccc(C(C)CCC(C)c2cc(F)c(C(C)C)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H31Cl2F/c1-14(2)18-9-10-19(22(25)11-18)16(5)7-8-17(6)21-13-24(27)20(15(3)4)12-23(21)26/h9-17H,7-8H2,1-6H3 |
| InChIKey | OIMNYEXSOOKMBJ-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |