C29H26FN3O3 — CID 155383630
[4-[5-(4-fluorophenyl)-6-(8-oxabicyclo[3.2.1]octan-3-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]phenyl]methanediol (PubChem CID 155383630) has the molecular formula C29H26FN3O3 and a molecular weight of 483.54 g/mol. Its IUPAC name is [4-[5-(4-fluorophenyl)-6-(8-oxabicyclo[3.2.1]octan-3-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]phenyl]methanediol.
| Compound Name | [4-[5-(4-fluorophenyl)-6-(8-oxabicyclo[3.2.1]octan-3-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]phenyl]methanediol |
|---|---|
| PubChem CID | 155383630 |
| Molecular Formula | C29H26FN3O3 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | [4-[5-(4-fluorophenyl)-6-(8-oxabicyclo[3.2.1]octan-3-yl)-1H-pyrrolo[2,3-f]indazol-7-yl]phenyl]methanediol |
| SMILES | OC(O)c1ccc(-c2c(C3CC4CCC(C3)O4)n(-c3ccc(F)cc3)c3cc4cn[nH]c4cc23)cc1 |
| InChI | InChI=1S/C29H26FN3O3/c30-20-5-7-21(8-6-20)33-26-13-19-15-31-32-25(19)14-24(26)27(16-1-3-17(4-2-16)29(34)35)28(33)18-11-22-9-10-23(12-18)36-22/h1-8,13-15,18,22-23,29,34-35H,9-12H2,(H,31,32) |
| InChIKey | WWXMOILNNXSOPF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|