C12H8ClF3N2O — CID 155386797
2-(chloromethyl)-6-[3-(difluoromethoxy)-4-fluorophenyl]pyrazine (PubChem CID 155386797) has the molecular formula C12H8ClF3N2O and a molecular weight of 288.66 g/mol. Its IUPAC name is 2-(chloromethyl)-6-[3-(difluoromethoxy)-4-fluorophenyl]pyrazine.
| Compound Name | 2-(chloromethyl)-6-[3-(difluoromethoxy)-4-fluorophenyl]pyrazine |
|---|---|
| PubChem CID | 155386797 |
| Molecular Formula | C12H8ClF3N2O |
| Molecular Weight | 288.66 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-(chloromethyl)-6-[3-(difluoromethoxy)-4-fluorophenyl]pyrazine |
| SMILES | Fc1ccc(-c2cncc(CCl)n2)cc1OC(F)F |
| InChI | InChI=1S/C12H8ClF3N2O/c13-4-8-5-17-6-10(18-8)7-1-2-9(14)11(3-7)19-12(15)16/h1-3,5-6,12H,4H2 |
| InChIKey | BWDAFSADIPKTQV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|