C17H17F3N2O3 — CID 155405952
2-[[5-[3-(difluoromethoxy)-4-fluorophenyl]-3-pyridinyl]methyl-methylamino]ethyl formate (PubChem CID 155405952) has the molecular formula C17H17F3N2O3 and a molecular weight of 354.33 g/mol. Its IUPAC name is 2-[[5-[3-(difluoromethoxy)-4-fluorophenyl]-3-pyridinyl]methyl-methylamino]ethyl formate.
| Compound Name | 2-[[5-[3-(difluoromethoxy)-4-fluorophenyl]-3-pyridinyl]methyl-methylamino]ethyl formate |
|---|---|
| PubChem CID | 155405952 |
| Molecular Formula | C17H17F3N2O3 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[[5-[3-(difluoromethoxy)-4-fluorophenyl]-3-pyridinyl]methyl-methylamino]ethyl formate |
| SMILES | CN(CCOC=O)Cc1cncc(-c2ccc(F)c(OC(F)F)c2)c1 |
| InChI | InChI=1S/C17H17F3N2O3/c1-22(4-5-24-11-23)10-12-6-14(9-21-8-12)13-2-3-15(18)16(7-13)25-17(19)20/h2-3,6-9,11,17H,4-5,10H2,1H3 |
| InChIKey | HTYNYUKLUVSAOP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|