C24H34Cl2N6S — CID 155387427
2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-6-(2,3-dichlorophenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine (PubChem CID 155387427) has the molecular formula C24H34Cl2N6S and a molecular weight of 509.55 g/mol. Its IUPAC name is 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-6-(2,3-dichlorophenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine.
| Compound Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-6-(2,3-dichlorophenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine |
|---|---|
| PubChem CID | 155387427 |
| Molecular Formula | C24H34Cl2N6S |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 2-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-6-(2,3-dichlorophenyl)-N-(2,4,4-trimethylpentan-2-yl)imidazo[2,1-b][1,3,4]thiadiazol-5-amine |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2cccc(Cl)c2Cl)nc2sc(N3CCC(C)(CN)C3)nn12 |
| InChI | InChI=1S/C24H34Cl2N6S/c1-22(2,3)12-23(4,5)29-19-18(15-8-7-9-16(25)17(15)26)28-20-32(19)30-21(33-20)31-11-10-24(6,13-27)14-31/h7-9,29H,10-14,27H2,1-6H3 |
| InChIKey | OJHFKZYRJDERFO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 71.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |