C20H28O10 — CID 155387606
2-benzofuran-1,3-dione;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;hexanedioic acid (PubChem CID 155387606) has the molecular formula C20H28O10 and a molecular weight of 428.43 g/mol. Its IUPAC name is 2-benzofuran-1,3-dione;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;hexanedioic acid.
| Compound Name | 2-benzofuran-1,3-dione;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;hexanedioic acid |
|---|---|
| PubChem CID | 155387606 |
| Molecular Formula | C20H28O10 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 2-benzofuran-1,3-dione;2-ethyl-2-(hydroxymethyl)propane-1,3-diol;hexanedioic acid |
| SMILES | CCC(CO)(CO)CO.O=C(O)CCCCC(=O)O.O=C1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H4O3.C6H10O4.C6H14O3/c9-7-5-3-1-2-4-6(5)8(10)11-7;7-5(8)3-1-2-4-6(9)10;1-2-6(3-7,4-8)5-9/h1-4H;1-4H2,(H,7,8)(H,9,10);7-9H,2-5H2,1H3 |
| InChIKey | KFBKBYRCOJJFDQ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|