C18H20ClN3O3 — CID 155388867
N-[(5-chloro-2-hydroxyphenyl)methyl]-4-(2,2-dimethylpropanoylamino)pyridine-2-carboxamide (PubChem CID 155388867) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is N-[(5-chloro-2-hydroxyphenyl)methyl]-4-(2,2-dimethylpropanoylamino)pyridine-2-carboxamide.
| Compound Name | N-[(5-chloro-2-hydroxyphenyl)methyl]-4-(2,2-dimethylpropanoylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155388867 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[(5-chloro-2-hydroxyphenyl)methyl]-4-(2,2-dimethylpropanoylamino)pyridine-2-carboxamide |
| SMILES | CC(C)(C)C(=O)Nc1ccnc(C(=O)NCc2cc(Cl)ccc2O)c1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-18(2,3)17(25)22-13-6-7-20-14(9-13)16(24)21-10-11-8-12(19)4-5-15(11)23/h4-9,23H,10H2,1-3H3,(H,21,24)(H,20,22,25) |
| InChIKey | FPGRORQMHFCZQK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|