About (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid
(2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid (PubChem CID 155390732) has the molecular formula C12H24N4O6
and a molecular weight of 320.35 g/mol. Its IUPAC name is (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid.
Molecular Properties
| Compound Name | (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid |
| PubChem CID | 155390732 |
| Molecular Formula | C12H24N4O6 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid |
| SMILES | N[C@@H](CCNCC=O)C(=O)O.N[C@H](CCNCC=O)C(=O)O |
| InChI | InChI=1S/2C6H12N2O3/c2*7-5(6(10)11)1-2-8-3-4-9/h2*4-5,8H,1-3,7H2,(H,10,11)/t2*5-/m10/s1 |
| InChIKey | FKHBUHIWHWWERU-JZLFTLSWSA-N |
| XLogP | -2.85 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid?
The IUPAC name of (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid (CID 155390732) is (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid.
What is the SMILES notation for (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid?
The canonical SMILES for (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid is N[C@@H](CCNCC=O)C(=O)O.N[C@H](CCNCC=O)C(=O)O.
What is the InChIKey of (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid?
The InChIKey is FKHBUHIWHWWERU-JZLFTLSWSA-N. The full InChI is InChI=1S/2C6H12N2O3/c2*7-5(6(10)11)1-2-8-3-4-9/h2*4-5,8H,1-3,7H2,(H,10,11)/t2*5-/m10/s1.
What are the key properties of (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid?
(2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid has a molecular weight of 320.35 g/mol, XLogP of -2.85, 12 rotatable bonds, 6 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-4-(2-oxoethylamino)butanoic acid;(2S)-2-amino-4-(2-oxoethylamino)butanoic acid is sourced from PubChem (CID 155390732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).