C4H11N3O4 — CID 3945711
2-amino-4-(2,2-dihydroxyhydrazinyl)butanoic acid (PubChem CID 3945711) has the molecular formula C4H11N3O4 and a molecular weight of 165.15 g/mol. Its IUPAC name is 2-amino-4-(2,2-dihydroxyhydrazinyl)butanoic acid.
| Compound Name | 2-amino-4-(2,2-dihydroxyhydrazinyl)butanoic acid |
|---|---|
| PubChem CID | 3945711 |
| Molecular Formula | C4H11N3O4 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | 2-amino-4-(2,2-dihydroxyhydrazinyl)butanoic acid |
| SMILES | NC(CCNN(O)O)C(=O)O |
| InChI | InChI=1S/C4H11N3O4/c5-3(4(8)9)1-2-6-7(10)11/h3,6,10-11H,1-2,5H2,(H,8,9) |
| InChIKey | MIWINVDFPWXLPY-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|