C4H9N2O4S- — CID 174440581
(2S)-2-amino-1-hydroxy-1-oxo-4-(sulfinatoamino)butane (PubChem CID 174440581) has the molecular formula C4H9N2O4S- and a molecular weight of 181.19 g/mol. Its IUPAC name is (2S)-2-amino-1-hydroxy-1-oxo-4-(sulfinatoamino)butane.
| Compound Name | (2S)-2-amino-1-hydroxy-1-oxo-4-(sulfinatoamino)butane |
|---|---|
| PubChem CID | 174440581 |
| Molecular Formula | C4H9N2O4S- |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | (2S)-2-amino-1-hydroxy-1-oxo-4-(sulfinatoamino)butane |
| SMILES | N[C@@H](CCNS(=O)[O-])C(=O)O |
| InChI | InChI=1S/C4H10N2O4S/c5-3(4(7)8)1-2-6-11(9)10/h3,6H,1-2,5H2,(H,7,8)(H,9,10)/p-1/t3-/m0/s1 |
| InChIKey | ZOVAJHRIVYSHAX-VKHMYHEASA-M |
| XLogP | -1.83 |
| TPSA | 115.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|