C8H20N3O5S- — CID 174784659
(2S)-2,6-diaminohexanoic acid;1-hydroxy-2-(sulfinatoamino)ethane (PubChem CID 174784659) has the molecular formula C8H20N3O5S- and a molecular weight of 270.33 g/mol. Its IUPAC name is (2S)-2,6-diaminohexanoic acid;1-hydroxy-2-(sulfinatoamino)ethane.
| Compound Name | (2S)-2,6-diaminohexanoic acid;1-hydroxy-2-(sulfinatoamino)ethane |
|---|---|
| PubChem CID | 174784659 |
| Molecular Formula | C8H20N3O5S- |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (2S)-2,6-diaminohexanoic acid;1-hydroxy-2-(sulfinatoamino)ethane |
| SMILES | NCCCC[C@H](N)C(=O)O.O=S([O-])NCCO |
| InChI | InChI=1S/C6H14N2O2.C2H7NO3S/c7-4-2-1-3-5(8)6(9)10;4-2-1-3-7(5)6/h5H,1-4,7-8H2,(H,9,10);3-4H,1-2H2,(H,5,6)/p-1/t5-;/m0./s1 |
| InChIKey | ZSCMRXQDWRXZPY-JEDNCBNOSA-M |
| XLogP | -2.11 |
| TPSA | 161.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|