C18H17FN2O5 — CID 155391125
(2S,4R)-2-[[4-(2-fluorophenyl)phenoxy]carbamoyl]-4-hydroxypyrrolidine-1-carboxylic acid (PubChem CID 155391125) has the molecular formula C18H17FN2O5 and a molecular weight of 360.34 g/mol. Its IUPAC name is (2S,4R)-2-[[4-(2-fluorophenyl)phenoxy]carbamoyl]-4-hydroxypyrrolidine-1-carboxylic acid.
| Compound Name | (2S,4R)-2-[[4-(2-fluorophenyl)phenoxy]carbamoyl]-4-hydroxypyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 155391125 |
| Molecular Formula | C18H17FN2O5 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | (2S,4R)-2-[[4-(2-fluorophenyl)phenoxy]carbamoyl]-4-hydroxypyrrolidine-1-carboxylic acid |
| SMILES | O=C(NOc1ccc(-c2ccccc2F)cc1)[C@@H]1C[C@@H](O)CN1C(=O)O |
| InChI | InChI=1S/C18H17FN2O5/c19-15-4-2-1-3-14(15)11-5-7-13(8-6-11)26-20-17(23)16-9-12(22)10-21(16)18(24)25/h1-8,12,16,22H,9-10H2,(H,20,23)(H,24,25)/t12-,16+/m1/s1 |
| InChIKey | PSKGYLFGBAYODB-WBMJQRKESA-N |
| XLogP | 2.02 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|