C18H18N2O4 — CID 684625
phenyl (2S,4R)-4-hydroxy-2-(phenylcarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 684625) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is phenyl (2S,4R)-4-hydroxy-2-(phenylcarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | phenyl (2S,4R)-4-hydroxy-2-(phenylcarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 684625 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | phenyl (2S,4R)-4-hydroxy-2-(phenylcarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1ccccc1)[C@@H]1C[C@@H](O)CN1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H18N2O4/c21-14-11-16(17(22)19-13-7-3-1-4-8-13)20(12-14)18(23)24-15-9-5-2-6-10-15/h1-10,14,16,21H,11-12H2,(H,19,22)/t14-,16+/m1/s1 |
| InChIKey | JXMWMOWGPBFZKR-ZBFHGGJFSA-N |
| XLogP | 2.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |