C24H22N4O4 — CID 126189043
phenyl (2S,4R)-4-hydroxy-2-[(4-phenyldiazenylphenyl)carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 126189043) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is phenyl (2S,4R)-4-hydroxy-2-[(4-phenyldiazenylphenyl)carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | phenyl (2S,4R)-4-hydroxy-2-[(4-phenyldiazenylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126189043 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | phenyl (2S,4R)-4-hydroxy-2-[(4-phenyldiazenylphenyl)carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Nc1ccc(/N=N/c2ccccc2)cc1)[C@@H]1C[C@@H](O)CN1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C24H22N4O4/c29-20-15-22(28(16-20)24(31)32-21-9-5-2-6-10-21)23(30)25-17-11-13-19(14-12-17)27-26-18-7-3-1-4-8-18/h1-14,20,22,29H,15-16H2,(H,25,30)/b27-26+/t20-,22+/m1/s1 |
| InChIKey | NVSMMNHWEBOESG-CQWCOOMLSA-N |
| XLogP | 4.67 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|